ChemNet > CAS > 9006-26-2 poly(ethylene-alt-maleic anhydride)
9006-26-2 poly(ethylene-alt-maleic anhydride)
| product Name |
poly(ethylene-alt-maleic anhydride) |
| CAS No |
9006-26-2 |
| Synonyms |
Ethylene/MA copolymer; 2,5-Furandione, polymer with ethene; Ethylene-maleic anhydride copolymer; EMA 1605; Ethylene maleic anhydride co-polymer; Ethylene, polymer with maleic anhydride; Maleic anhydride ethene polymer; Maleic anhydride, polymer with ethylene; Poly(ethylene-maleic anhydride); Polyethylene maleic anhydride copolymer; RPC 1022; Sholex ET 182; WCZ 628; Maleic anhydride polymer w/ethane; furan-2,5-dione - ethene (1:1); 3-oxabicyclo[3.2.0]hept-1(5)-ene-2,4-dione |
| Molecular Formula |
C6H4O3 |
| Molecular Weight |
124.0942 |
| InChI |
InChI=1/C6H4O3/c7-5-3-1-2-4(3)6(8)9-5/h1-2H2 |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Boiling point |
287.4°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
144.6°C |
| Vapour Pressur |
0.00249mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
