ChemNet > CAS > 9010-85-9 poly(isobutylene-co-isoprene)
9010-85-9 poly(isobutylene-co-isoprene)
| product Name |
poly(isobutylene-co-isoprene) |
| CAS No |
9010-85-9 |
| Synonyms |
Isobutylene/isoprene copolymer; 2-Methyl-1,3-butadiene polymer with 2-methyl-1-propene; Butyl rubber; 1,3-Butadiene, 2-methyl-, polymer with 2-methyl-1-propene; Poly(isobutylene-co-isoprene); 2-methylbuta-1,3-diene - 2-methylprop-1-ene (1:1) |
| Molecular Formula |
C9H16 |
| Molecular Weight |
124.2233 |
| InChI |
InChI=1/C5H8.C4H8/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;1H2,2-3H3 |
| Molecular Structure |
|
| Boiling point |
34.1°C at 760 mmHg |
| Vapour Pressur |
549mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
