ChemNet > CAS > 9010-86-0 Ethylene/ethyl acrylate copolymer
9010-86-0 Ethylene/ethyl acrylate copolymer
| product Name |
Ethylene/ethyl acrylate copolymer |
| CAS No |
9010-86-0 |
| Synonyms |
Poly(ethylene-co-ethyl acrylate); ethyl prop-2-enoate - ethene (1:1) |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C5H8O2.C2H4/c1-3-5(6)7-4-2;1-2/h3H,1,4H2,2H3;1-2H2 |
| Molecular Structure |
|
| Boiling point |
99.5°C at 760 mmHg |
| Flash point |
15.6°C |
| Vapour Pressur |
38.2mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
