ChemNet > CAS > 9011-11-4 poly(styrene-co-alpha-methylstyrene)
9011-11-4 poly(styrene-co-alpha-methylstyrene)
| product Name |
poly(styrene-co-alpha-methylstyrene) |
| CAS No |
9011-11-4 |
| Synonyms |
Benzene, ethenyl-, polymer with (1-methylethenyl)benzene; Ethenylbenzene, copolymer with (1-methylethenyl)benzene; ethenylbenzene - prop-1-en-2-ylbenzene (1:1) |
| Molecular Formula |
C17H18 |
| Molecular Weight |
222.3248 |
| InChI |
InChI=1/C9H10.C8H8/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| Molecular Structure |
|
| Boiling point |
162.5°C at 760 mmHg |
| Flash point |
45.6°C |
| Vapour Pressur |
2.83mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
