ChemNet > CAS > 9036-63-9 Poly(iso-octyl acrylate) (in Toluene,Unit weight does not include wt. of solvent)
9036-63-9 Poly(iso-octyl acrylate) (in Toluene,Unit weight does not include wt. of solvent)
| product Name |
Poly(iso-octyl acrylate) (in Toluene,Unit weight does not include wt. of solvent) |
| CAS No |
9036-63-9 |
| Synonyms |
2-Propenoic acid, isooctyl ester, homopolymer; CCRIS 4353; Isooctyl 2-propenoate, homopolymer; Isooctyl acrylate homopolymer; Isooctyl acrylate polymer; 6-methylheptyl propanoate |
| Molecular Formula |
C11H22O2 |
| Molecular Weight |
186.2912 |
| InChI |
InChI=1/C11H22O2/c1-4-11(12)13-9-7-5-6-8-10(2)3/h10H,4-9H2,1-3H3 |
| Molecular Structure |
|
| Density |
0.87g/cm3 |
| Boiling point |
214.2°C at 760 mmHg |
| Refractive index |
1.425 |
| Flash point |
82.9°C |
| Vapour Pressur |
0.158mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
