ChemNet > CAS > 90459-62-4 Octadecanoic acid, reaction products with diethylenetriamine, di-Me sulfate-quaternized
90459-62-4 Octadecanoic acid, reaction products with diethylenetriamine, di-Me sulfate-quaternized
| product Name |
Octadecanoic acid, reaction products with diethylenetriamine, di-Me sulfate-quaternized |
| CAS No |
90459-62-4 |
| Synonyms |
Stearic acid, condensate with diethylenetriamine, product reacted with dimethyl sulfate; N-(2-aminoethyl)ethane-1,2-diamine; dimethyl sulfate; stearic acid |
| Molecular Formula |
C24H55N3O6S |
| Molecular Weight |
513.775 |
| InChI |
InChI=1/C18H36O2.C4H13N3.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-5-7(3,4)6-2/h2-17H2,1H3,(H,19,20);7H,1-6H2;1-2H3 |
| EINECS |
291-707-5 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
