ChemNet > CAS > 90563-93-2 4-methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid
90563-93-2 4-methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid
| product Name |
4-methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| CAS No |
90563-93-2 |
| Synonyms |
3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid; (2S)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate; (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
| Molecular Formula |
C9H8NO3 |
| Molecular Weight |
178.1653 |
| InChI |
InChI=1/C9H9NO3/c11-9(12)8-5-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12)/p-1/t8-/m1/s1 |
| Molecular Structure |
|
| Boiling point |
399.7°C at 760 mmHg |
| Flash point |
195.6°C |
| Vapour Pressur |
4.16E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
