ChemNet > CAS > 90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
| product Name |
3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione |
| CAS No |
90567-39-8 |
| Synonyms |
3-(hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
| Molecular Formula |
C4H6N2OS3 |
| Molecular Weight |
194.2982 |
| InChI |
InChI=1/C4H6N2OS3/c1-9-3-5-6(2-7)4(8)10-3/h7H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.64g/cm3 |
| Melting point |
72℃ |
| Boiling point |
306.9°C at 760 mmHg |
| Refractive index |
1.771 |
| Flash point |
139.4°C |
| Vapour Pressur |
6.94E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
