ChemNet > CAS > 90721-27-0 1-benzofuran-5-carboxylic acid
90721-27-0 1-benzofuran-5-carboxylic acid
| product Name |
1-benzofuran-5-carboxylic acid |
| CAS No |
90721-27-0 |
| Molecular Formula |
C9H6O3 |
| Molecular Weight |
162.1421 |
| InChI |
InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
| Molecular Structure |
|
| Density |
1.363g/cm3 |
| Melting point |
188℃ |
| Boiling point |
325.6°C at 760 mmHg |
| Refractive index |
1.649 |
| Flash point |
150.7°C |
| Vapour Pressur |
9.31E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
