ChemNet > CAS > 91138-00-0 5-Methyl-1-phenylpyrazole-4-carboxylic acid
91138-00-0 5-Methyl-1-phenylpyrazole-4-carboxylic acid
| product Name |
5-Methyl-1-phenylpyrazole-4-carboxylic acid |
| CAS No |
91138-00-0 |
| Synonyms |
5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
| Molecular Formula |
C11H10N2O2 |
| Molecular Weight |
202.2093 |
| InChI |
InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Melting point |
163℃ |
| Boiling point |
382.9°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
185.4°C |
| Vapour Pressur |
1.51E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
