product Name |
D(+)-Galacturonic acid monohydrate |
CAS No |
91510-62-2 |
Synonyms |
D-(+)-Galacturonic acid monohydrate; D-galactopyranuronic acid hydrate; (2S,3R,4S,5R,6R)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylate (non-preferred name); (2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylate (non-preferred name) |
Molecular Formula |
C6H9O7 |
Molecular Weight |
193.132 |
InChI |
InChI=1/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2+,3+,4-,6-/m0/s1 |
Molecular Structure |
|
Melting point |
164-165℃ |
Boiling point |
495.235°C at 760 mmHg |
Flash point |
211.111°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|