ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
| product Name |
2,3-Benzanthracene |
| CAS No |
92-24-0 |
| Synonyms |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
| Molecular Formula |
C18H12 |
| Molecular Weight |
228.2879 |
| InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| EINECS |
202-138-9 |
| Molecular Structure |
|
| Density |
1.19g/cm3 |
| Melting point |
300℃ |
| Boiling point |
436.7°C at 760 mmHg |
| Refractive index |
1.771 |
| Flash point |
209.1°C |
| Vapour Pressur |
2.02E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
