ChemNet > CAS > 922-55-4 Lanthionine
922-55-4 Lanthionine
| product Name |
Lanthionine |
| CAS No |
922-55-4 |
| Synonyms |
lanthionine, mixture of dl and meso; di(2-amino-2-carboxyethyl) sulphide; S-[(2R)-2-amino-2-carboxyethyl]-D-cysteine; S-[(2R)-2-amino-2-carboxyethyl]-L-cysteine; (2S,2'S)-3,3'-sulfanediylbis(2-ammoniopropanoate) |
| Molecular Formula |
C6H12N2O4S |
| Molecular Weight |
208.2355 |
| InChI |
InChI=1/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| EINECS |
213-076-7 |
| Molecular Structure |
|
| Density |
1.499g/cm3 |
| Melting point |
280-283℃ |
| Boiling point |
462.6°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
233.5°C |
| Vapour Pressur |
7.72E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
