ChemNet > CAS > 928-47-2 S-n-Butyl thioacetate
928-47-2 S-n-Butyl thioacetate
| product Name |
S-n-Butyl thioacetate |
| CAS No |
928-47-2 |
| Synonyms |
Thioacetic acid S-n-butyl ester; S-butyl ethanethioate; S-butan-2-yl ethanethioate |
| Molecular Formula |
C6H12OS |
| Molecular Weight |
132.2239 |
| InChI |
InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
| Molecular Structure |
|
| Density |
0.95g/cm3 |
| Boiling point |
158.1°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
44°C |
| Vapour Pressur |
2.67mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
