ChemNet > CAS > 93-58-3 Methyl benzoate
93-58-3 Methyl benzoate
| product Name |
Methyl benzoate |
| Synonyms |
Benzoic acid methyl ester; clorius; essence of niobe; methyl benzenecarboxylate; Niobe oil; Oil of niobe; oniobe oil; oxidate le |
| Molecular Formula |
C8H8O2 |
| Molecular Weight |
136.1479 |
| InChI |
InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
| CAS Registry Number |
93-58-3 |
| EINECS |
202-259-7 |
| Molecular Structure |
|
| Density |
1.069g/cm3 |
| Melting point |
-12℃ |
| Boiling point |
199.5°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
80.2°C |
| Water solubility |
<0.1 g/100 mL at 22.5℃ |
| Vapour Pressur |
0.34mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S36:;
|
| MSDS |
Methyl benzoate Material Safety Data Sheet
|
|
