ChemNet > CAS > 930-61-0 2,4-Dimethyl-2-imidazoline
930-61-0 2,4-Dimethyl-2-imidazoline
| product Name |
2,4-Dimethyl-2-imidazoline |
| CAS No |
930-61-0 |
| Synonyms |
1H-Imidazole, 4,5-dihydro-2,5-dimethyl-; 1H-Imidazole, 4,5-dihydro-2,4-dimethyl-; 4,5-Dihydro-2,4-dimethyl-1H-imidazole; 2,5-dimethyl-4,5-dihydro-1H-imidazole |
| Molecular Formula |
C5H10N2 |
| Molecular Weight |
98.1463 |
| InChI |
InChI=1/C5H10N2/c1-4-3-6-5(2)7-4/h4H,3H2,1-2H3,(H,6,7) |
| EINECS |
213-220-9 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
198.6°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
73.9°C |
| Vapour Pressur |
0.504mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
