ChemNet > CAS > 93041-45-3 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid
93041-45-3 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid
| product Name |
3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid |
| CAS No |
93041-45-3 |
| Synonyms |
3-(4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid |
| Molecular Formula |
C12H11NO4 |
| Molecular Weight |
233.22 |
| InChI |
InChI=1/C12H11NO4/c1-7-10(12(14)15)11(13-17-7)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,14,15) |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Melting point |
191℃ |
| Boiling point |
399.1°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
195.2°C |
| Vapour Pressur |
4.37E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
