ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
| product Name |
1,2-Cyclohexanediol, mixture of cis and trans |
| CAS No |
931-17-9 |
| Synonyms |
1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
| Molecular Formula |
C6H12O2 |
| Molecular Weight |
116.16 |
| InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
| EINECS |
213-229-8 |
| Molecular Structure |
|
| Melting point |
73-77℃ |
| Boiling point |
118-120℃ (10 mmHg) |
| Water solubility |
soluble |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
