ChemNet > CAS > 932-66-1 1-Acetyl-1-cyclohexene
932-66-1 1-Acetyl-1-cyclohexene
| product Name |
1-Acetyl-1-cyclohexene |
| CAS No |
932-66-1 |
| Synonyms |
cyclohex-1-enyl methyl ketone; 1-(cyclohex-1-en-1-yl)ethanone |
| Molecular Formula |
C8H12O |
| Molecular Weight |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
| EINECS |
213-256-5 |
| Molecular Structure |
|
| Density |
0.962g/cm3 |
| Melting point |
73-202℃ |
| Boiling point |
201.7°C at 760 mmHg |
| Refractive index |
1.477 |
| Flash point |
73.2°C |
| Vapour Pressur |
0.304mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
