ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
| product Name |
2,3,5-Trichlorophenol |
| CAS No |
933-78-8 |
| Molecular Formula |
C6H3Cl3O |
| Molecular Weight |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| EINECS |
213-272-2 |
| Molecular Structure |
|
| Density |
1.596g/cm3 |
| Melting point |
57-60℃ |
| Boiling point |
250.2°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
105.1°C |
| Vapour Pressur |
0.0139mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
