ChemNet > CAS > 935-44-4 1-Phenyl-1-cyclopropanecarbonitrile
935-44-4 1-Phenyl-1-cyclopropanecarbonitrile
| product Name |
1-Phenyl-1-cyclopropanecarbonitrile |
| CAS No |
935-44-4 |
| Synonyms |
1-Phenylcyclopropanecarbonitrile |
| Molecular Formula |
C10H9N |
| Molecular Weight |
143.1852 |
| InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| EINECS |
213-304-5 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Boiling point |
238.5°C at 760 mmHg |
| Refractive index |
1.571 |
| Flash point |
99°C |
| Vapour Pressur |
0.0422mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
