ChemNet > CAS > 937-39-3 Phenylacetic hydrazide
937-39-3 Phenylacetic hydrazide
| product Name |
Phenylacetic hydrazide |
| CAS No |
937-39-3 |
| Synonyms |
benzeneaceticacid,hydrazide; SPECS AN-068/40177140; RARECHEM BG FB 0137; PHENYLACETIC ACID HYDRAZIDE; PHENYLACETHYDRAZIDE; 2-PHENYLACETIC ACID HYDRAZIDE; ASISCHEM R35457; 2-phenylacetohydrazide |
| Molecular Formula |
C8H10N2O |
| Molecular Weight |
150.1778 |
| InChI |
InChI=1/C8H10N2O/c9-10-8(11)6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
| EINECS |
213-328-6 |
| Molecular Structure |
|
| Density |
1.138g/cm3 |
| Melting point |
115-117℃ |
| Boiling point |
364.9°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
174.5°C |
| Vapour Pressur |
1.63E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
