ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
| product Name |
p-Tolyl chlorothionoformate |
| CAS No |
937-63-3 |
| Synonyms |
p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
| Molecular Formula |
C8H7ClOS |
| Molecular Weight |
186.6586 |
| InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| EINECS |
213-333-3 |
| Molecular Structure |
|
| Density |
1.277g/cm3 |
| Boiling point |
244.8°C at 760 mmHg |
| Refractive index |
1.598 |
| Flash point |
101.8°C |
| Vapour Pressur |
0.0466mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
