ChemNet > CAS > 93957-49-4 1-Isopropyl-3-(4-fluorophenyl)indole
93957-49-4 1-Isopropyl-3-(4-fluorophenyl)indole
| product Name |
1-Isopropyl-3-(4-fluorophenyl)indole |
| CAS No |
93957-49-4 |
| Synonyms |
3-(4-Fluorophenyl)-1-Isopropyl-1H-Indole; N-isopropyl-3-(4-fluorophenyl)-1H-indole; 3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole; Fluvastatin sodium intermediate F1; 3-(4-Fluorobenzene)-1-(1-methylethyl)-1-H-indole; 3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indole; 3-(4-3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol |
| Molecular Formula |
C17H16FN |
| Molecular Weight |
253.314 |
| InChI |
InChI=1/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3 |
| EINECS |
418-790-4 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
389.6°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
189.4°C |
| Vapour Pressur |
6.32E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
