ChemNet > CAS > 94-32-6 ethyl 4-(butylamino)benzoate
94-32-6 ethyl 4-(butylamino)benzoate
| product Name |
ethyl 4-(butylamino)benzoate |
| CAS No |
94-32-6 |
| Synonyms |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
| Molecular Formula |
C13H19NO2 |
| Molecular Weight |
221.2955 |
| InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
| EINECS |
202-322-9 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Melting point |
68-70℃ |
| Boiling point |
338.4°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
158.4°C |
| Vapour Pressur |
9.87E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
