ChemNet > CAS > 940-90-9 benzoic acid, compound with diethylamine (1:1)
940-90-9 benzoic acid, compound with diethylamine (1:1)
| product Name |
benzoic acid, compound with diethylamine (1:1) |
| CAS No |
940-90-9 |
| Synonyms |
Benzoic acid, compound with diethylamine (1:1); N-ethylethanaminium benzoate |
| Molecular Formula |
C11H17NO2 |
| Molecular Weight |
195.2582 |
| InChI |
InChI=1/C7H6O2.C4H11N/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,8,9);5H,3-4H2,1-2H3 |
| EINECS |
213-377-3 |
| Molecular Structure |
|
| Boiling point |
317.9°C at 760 mmHg |
| Flash point |
146.1°C |
| Vapour Pressur |
0.000156mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
