ChemNet > CAS > 94086-68-7 azelaic acid, compound with piperazine-1,4-diethanol
94086-68-7 azelaic acid, compound with piperazine-1,4-diethanol
| product Name |
azelaic acid, compound with piperazine-1,4-diethanol |
| CAS No |
94086-68-7 |
| Synonyms |
Azelaic acid, compound with piperazine-1,4-diethanol; 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; nonanedioic acid |
| Molecular Formula |
C17H34N2O6 |
| Molecular Weight |
362.4617 |
| InChI |
InChI=1/C9H16O4.C8H18N2O2/c10-8(11)6-4-2-1-3-5-7-9(12)13;11-7-5-9-1-2-10(4-3-9)6-8-12/h1-7H2,(H,10,11)(H,12,13);11-12H,1-8H2 |
| EINECS |
301-857-6 |
| Molecular Structure |
|
| Boiling point |
602.9°C at 760 mmHg |
| Flash point |
318.4°C |
| Vapour Pressur |
4.73E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
