ChemNet > CAS > 94201-90-8 Phosphoric acid, 2-ethylhexyl ester, compd. with 2-ethyl-1-hexanamine
94201-90-8 Phosphoric acid, 2-ethylhexyl ester, compd. with 2-ethyl-1-hexanamine
| product Name |
Phosphoric acid, 2-ethylhexyl ester, compd. with 2-ethyl-1-hexanamine |
| CAS No |
94201-90-8 |
| Synonyms |
303-681-5; 2-ethylhexan-1-amine; 2-ethylhexyl dihydrogen phosphate |
| Molecular Formula |
C16H38NO4P |
| Molecular Weight |
339.451 |
| InChI |
InChI=1/C8H19N.C8H19O4P/c1-3-5-6-8(4-2)7-9;1-3-5-6-8(4-2)7-12-13(9,10)11/h8H,3-7,9H2,1-2H3;8H,3-7H2,1-2H3,(H2,9,10,11) |
| EINECS |
303-681-5 |
| Molecular Structure |
|
| Boiling point |
457.1°C at 760 mmHg |
| Flash point |
230.3°C |
| Vapour Pressur |
1.26E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
