ChemNet > CAS > 945-49-3 cyclohexyl(phenyl)methanol
945-49-3 cyclohexyl(phenyl)methanol
| product Name |
cyclohexyl(phenyl)methanol |
| CAS No |
945-49-3 |
| Synonyms |
Methanol, cyclohexylphenyl-; 3-06-00-02527 (Beilstein Handbook Reference); BRN 2048295; Cyclohexanemethanol, alpha-phenyl-; Cyclohexylphenylmethanol; NSC 28611; Benzenemethanol, alpha-cyclohexyl- (9CI) |
| Molecular Formula |
C13H18O |
| Molecular Weight |
190.2814 |
| InChI |
InChI=1/C13H18O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-14H,2,5-6,9-10H2 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Melting point |
48℃ |
| Boiling point |
305.1°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
128.1°C |
| Vapour Pressur |
0.000368mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
