95-47-6 o-Xylene
| product Name |
o-Xylene |
| CAS No |
95-47-6 |
| Synonyms |
1,2-xylene; 1,2-Dimethylbenzene; ortho-xylene; Dimethylbenzene; Xylene |
| Molecular Formula |
C8H10 |
| Molecular Weight |
106.16 |
| InChI |
InChI=1/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3 |
| EINECS |
202-422-2 |
| Molecular Structure |
|
| Density |
0.879 |
| Melting point |
-26--23℃ |
| Boiling point |
143-145℃ |
| Refractive index |
1.505 |
| Flash point |
31℃ |
| Water solubility |
175 mg l-1 |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R10:;
R20/21:;
R38:;
|
| Safety Description |
S25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Lena |
| Telephone |
+86-13864755872 |
| Email |
lena@hongyanghuaxue.com |
| Address |
Meiyuan Building, Nanyi Road, Dongying City, Shandong Province, China |
| Description |
| Physical and chemical properties | Color and smell state: colorless, transparent and aromatic liquid | | Toxicity: poisoning | Flammability: flammable | | Density: 0.8611 | Volatility: non-volatile | | Boiling point: 144.4¡æ | Stability: stable | | Melting point: -25.5¡æ | Acidity and alkaline: neutral | | Spontaneous ignition point: 463¡æ | Flash point: 30¡æ | | Solubility: insoluble in water, miscible in most organic solvents such as ethanol, ether and chloroform | ...
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Mr Zhang |
| Telephone |
+86-577-88799961 88795800 88799963 88799960 88799962 |
| Email |
sales@cnjxchem.com |
| Address |
Yanjiang Industry Zone ,Wenzhou,China |
| Telephone |
+86-913-2195485 13609130560 13992360691 |
| Email |
expo@fumaric-acid.com |
| Address |
Liangshuiqiao,Dongguan,Weinan city,Shanxi province,China |
| Telephone |
+86-311-83980350 83980353 |
| Email |
zzk@sjzreagent.com |
| Address |
35 Zhinong Road, Shijiazhuang, Hebei, China |
|