ChemNet > CAS > 953-35-5 thiocyanic acid, compound with (4S-trans)-3,4-dimethyl-5-phenylthiazolidin-2-imine (1:1)
953-35-5 thiocyanic acid, compound with (4S-trans)-3,4-dimethyl-5-phenylthiazolidin-2-imine (1:1)
| product Name |
thiocyanic acid, compound with (4S-trans)-3,4-dimethyl-5-phenylthiazolidin-2-imine (1:1) |
| CAS No |
953-35-5 |
| Synonyms |
Thiocyanic acid, compound with (4S-trans)-3,4-dimethyl-5-phenylthiazolidin-2-imine (1:1); (4S,5S)-3,4-dimethyl-5-phenyl-thiazolidin-2-imine; thiocyanic acid |
| Molecular Formula |
C12H15N3S2 |
| Molecular Weight |
265.3976 |
| InChI |
InChI=1/C11H14N2S.CHNS/c1-8-10(14-11(12)13(8)2)9-6-4-3-5-7-9;2-1-3/h3-8,10,12H,1-2H3;3H/t8-,10+;/m0./s1 |
| EINECS |
213-464-6 |
| Molecular Structure |
|
| Boiling point |
422.1°C at 760 mmHg |
| Flash point |
209.1°C |
| Vapour Pressur |
2.47E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
