ChemNet > CAS > 954-81-4 N-(5-Bromopentyl)phthalimide
954-81-4 N-(5-Bromopentyl)phthalimide
| product Name |
N-(5-Bromopentyl)phthalimide |
| CAS No |
954-81-4 |
| Synonyms |
2-(5-bromopentyl)-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C13H14BrNO2 |
| Molecular Weight |
296.1598 |
| InChI |
InChI=1/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| Molecular Structure |
|
| Density |
1.459g/cm3 |
| Boiling point |
393.1°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
191.5°C |
| Vapour Pressur |
2.18E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
