ChemNet > CAS > 95883-10-6 2,5-Dimethylcinnamic acid
95883-10-6 2,5-Dimethylcinnamic acid
| product Name |
2,5-Dimethylcinnamic acid |
| CAS No |
95883-10-6 |
| Synonyms |
(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
| Molecular Formula |
C11H12O2 |
| Molecular Weight |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
| Molecular Structure |
|
| Density |
1.118g/cm3 |
| Boiling point |
307°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
212.2°C |
| Vapour Pressur |
0.000324mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
