959-22-8 4-Nitrophenyl benzoate
product Name |
4-Nitrophenyl benzoate |
CAS No |
959-22-8 |
Synonyms |
Benzoic acid 4-nitrophenyl ester |
Molecular Formula |
C13H9NO4 |
Molecular Weight |
243.2149 |
InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
Molecular Structure |
|
Density |
1.316g/cm3 |
Boiling point |
399.5°C at 760 mmHg |
Refractive index |
1.614 |
Flash point |
183.5°C |
Vapour Pressur |
1.37E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|