ChemNet > CAS > 959-23-9 4'-Methoxychalcone
959-23-9 4'-Methoxychalcone
| product Name |
4'-Methoxychalcone |
| CAS No |
959-23-9 |
| Synonyms |
4'-Methoxychalcone; AI3-25493; CCRIS 2231; EINECS 213-495-5; NSC 37157; 2-Propen-1-one, 1-(4-methoxyphenyl)-3-phenyl-; alpha-Styryl p-anisyl ketone; 1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one |
| Molecular Formula |
C16H14O2 |
| Molecular Weight |
238.2812 |
| InChI |
InChI=1/C16H14O2/c1-18-15-10-8-14(9-11-15)16(17)12-7-13-5-3-2-4-6-13/h2-12H,1H3/b12-7+ |
| EINECS |
213-495-5 |
| Molecular Structure |
|
| Density |
1.114g/cm3 |
| Melting point |
101-103℃ |
| Boiling point |
397.48°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
180.482°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
