ChemNet > CAS > 96424-68-9 2-Bromo-3-chloropyridine
96424-68-9 2-Bromo-3-chloropyridine
| product Name |
2-Bromo-3-chloropyridine |
| CAS No |
96424-68-9 |
| Molecular Formula |
C5H3BrClN |
| Molecular Weight |
192.441 |
| InChI |
InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H |
| Molecular Structure |
|
| Density |
1.736g/cm3 |
| Boiling point |
223.9°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
89.2°C |
| Vapour Pressur |
0.14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
