ChemNet > CAS > 96449-68-2 1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid
96449-68-2 1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid
| product Name |
1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid |
| CAS No |
96449-68-2 |
| Synonyms |
1-(4-fluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid |
| Molecular Formula |
C12H12FNO3 |
| Molecular Weight |
237.227 |
| InChI |
InChI=1/C12H12FNO3/c13-10-3-1-8(2-4-10)6-14-7-9(12(16)17)5-11(14)15/h1-4,9H,5-7H2,(H,16,17) |
| Molecular Structure |
|
| Density |
1.387g/cm3 |
| Melting point |
149℃ |
| Boiling point |
476.2°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
241.8°C |
| Vapour Pressur |
7.12E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
