product Name |
Ectoine |
Synonyms |
1,4,5,6-Tetrahydro-2-methyl-4-pyrimidinecarboxylic acid; 2-Methyl-1,4,5,6-tetrahydropyrimidine-4-carboxylic acid; 4-Pyrimidinecarboxylic acid, 1,4,5,6-tetrahydro-2-methyl-,
(+)-; (S)-2-Methyl-1,4,5,6-tetrahydropyrimidine-4-carboxylic acid sodium salt monohydrate;
; (4S)-2-methyl-3,4,5,6-tetrahydropyrimidine-4-carboxylic acid; Ectoin |
Molecular Formula |
C6H10N2O2 |
Molecular Weight |
142.1558 |
InChI |
InChI=1/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
CAS Registry Number |
96702-03-3 |
Molecular Structure |
|
Density |
1.37g/cm3 |
Boiling point |
381.5°C at 760 mmHg |
Refractive index |
1.596 |
Flash point |
184.5°C |
Vapour Pressur |
7.09E-07mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|