ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
| product Name |
3-Methyl-4-nitrobenzonitrile |
| CAS No |
96784-54-2 |
| Synonyms |
4-Nitro-m-tolunitrile;
|
| Molecular Formula |
C8H6N2O2 |
| Molecular Weight |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Melting point |
82-83℃ |
| Boiling point |
322.2°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
148.6°C |
| Vapour Pressur |
0.000284mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
