ChemNet > CAS > 96994-73-9 2-dimethylamino-6-fluorobenzonitrile
96994-73-9 2-dimethylamino-6-fluorobenzonitrile
| product Name |
2-dimethylamino-6-fluorobenzonitrile |
| CAS No |
96994-73-9 |
| Molecular Formula |
C9H9FN2 |
| Molecular Weight |
164.1796 |
| InChI |
InChI=1/C9H9FN2/c1-12(2)9-5-3-4-8(10)7(9)6-11/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Boiling point |
267.4°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
115.5°C |
| Vapour Pressur |
0.00816mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
