ChemNet > CAS > 98-81-7 alpha-bromostyrene
98-81-7 alpha-bromostyrene
| product Name |
alpha-bromostyrene |
| CAS No |
98-81-7 |
| Synonyms |
1-(1-Bromovinyl)benzene; (1-bromoethenyl)benzene |
| Molecular Formula |
C8H7Br |
| Molecular Weight |
183.0452 |
| InChI |
InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| EINECS |
202-702-4 |
| Molecular Structure |
|
| Density |
1.387g/cm3 |
| Melting point |
-44℃ |
| Boiling point |
212.6°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
98.3°C |
| Vapour Pressur |
0.249mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
