ChemNet > CAS > 98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
| product Name |
4-bromo-2-chlorophenyl isothiocyanate |
| CAS No |
98041-69-1 |
| Synonyms |
4-Bromo-2-chloroisothiocyanatobenzene; 1-bromo-2-chloro-4-isothiocyanatobenzene; 4-bromo-2-chloro-1-isothiocyanatobenzene |
| Molecular Formula |
C7H3BrClNS |
| Molecular Weight |
248.5274 |
| InChI |
InChI=1/C7H3BrClNS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Molecular Structure |
|
| Density |
1.63g/cm3 |
| Melting point |
46-48℃ |
| Boiling point |
315.2°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
144.4°C |
| Vapour Pressur |
0.000823mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
