ChemNet > CAS > 98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
| product Name |
5-(2,5-Dichlorophenyl)-1H-tetrazole |
| CAS No |
98555-71-6 |
| Synonyms |
5-(2,5-dichlorophenyl)-2H-tetrazole |
| Molecular Formula |
C7H4Cl2N4 |
| Molecular Weight |
215.0395 |
| InChI |
InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| Molecular Structure |
|
| Density |
1.574g/cm3 |
| Boiling point |
401.9°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
229.1°C |
| Vapour Pressur |
1.14E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
