ChemNet > CAS > 98892-75-2 1-Butyl-2,3-dimethylimidazolium chloride
98892-75-2 1-Butyl-2,3-dimethylimidazolium chloride
| product Name |
1-Butyl-2,3-dimethylimidazolium chloride |
| CAS No |
98892-75-2 |
| Synonyms |
1-butyl-2,3-dimethyl-1H-imidazol-3-ium chloride; 1-butyl-2,3-dimethyl-1H-imidazol-3-ium |
| Molecular Formula |
C9H17N2 |
| Molecular Weight |
153.2441 |
| InChI |
InChI=1/C9H17N2/c1-4-5-6-11-8-7-10(3)9(11)2/h7-8H,4-6H2,1-3H3/q+1 |
| Molecular Structure |
|
| Melting point |
99℃ |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
