ChemNet > CAS > 99-29-6 2-Bromo-6-chloro-4-nitroaniline
99-29-6 2-Bromo-6-chloro-4-nitroaniline
| product Name |
2-Bromo-6-chloro-4-nitroaniline |
| CAS No |
99-29-6 |
| Synonyms |
Benzenamine, 2-bromo-6-chloro-4-nitro-; NSC 88985; Aniline, 2-bromo-6-chloro-4-nitro-; 2-Chloro-4-nitro-6-bromoaniline |
| Molecular Formula |
C6H4BrClN2O2 |
| Molecular Weight |
251.4652 |
| InChI |
InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| EINECS |
202-745-9 |
| Molecular Structure |
|
| Density |
1.909g/cm3 |
| Boiling point |
344.7°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
162.3°C |
| Vapour Pressur |
6.47E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
