ChemNet > CAS > 99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
| product Name |
Methyl 4-hydroxy-3-nitrobenzoate |
| CAS No |
99-42-3 |
| Synonyms |
4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
| Molecular Formula |
C8H6NO5 |
| Molecular Weight |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| EINECS |
202-755-3 |
| Molecular Structure |
|
| Melting point |
74-76℃ |
| Boiling point |
311.1°C at 760 mmHg |
| Flash point |
141.9°C |
| Vapour Pressur |
0.000315mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
