ChemNet > CAS > 99799-10-7 3-methoxycyclohexanecarboxylic acid, mixture
99799-10-7 3-methoxycyclohexanecarboxylic acid, mixture
| product Name |
3-methoxycyclohexanecarboxylic acid, mixture |
| CAS No |
99799-10-7 |
| Synonyms |
3-Methoxycyclohexanecarboxylic acid,mixture of cis and trans; 3-methoxycyclohexanecarboxylic acid |
| Molecular Formula |
C8H14O3 |
| Molecular Weight |
158.195 |
| InChI |
InChI=1/C8H14O3/c1-11-7-4-2-3-6(5-7)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| Molecular Structure |
|
| Density |
1.094g/cm3 |
| Boiling point |
283.314°C at 760 mmHg |
| Refractive index |
1.471 |
| Flash point |
105.308°C |
| Vapour Pressur |
0.001mmHg at 25°C |
|