ChemNet > CAS > 998-93-6 4-Bromoheptane
998-93-6 4-Bromoheptane
| product Name |
4-Bromoheptane |
| CAS No |
998-93-6 |
| Synonyms |
Heptane, 4-bromo- |
| Molecular Formula |
C7H15Br |
| Molecular Weight |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-3-5-7(8)6-4-2/h7H,3-6H2,1-2H3 |
| EINECS |
213-653-3 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
168°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
48.4°C |
| Vapour Pressur |
2.18mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
