ChemNet > CAS > 26811-08-5 Formaldehyde, oligomeric reaction products with 5,5-dimethyl-2,4-imidazolidinedione
26811-08-5 Formaldehyde, oligomeric reaction products with 5,5-dimethyl-2,4-imidazolidinedione
| product Name |
Formaldehyde, oligomeric reaction products with 5,5-dimethyl-2,4-imidazolidinedione |
| CAS No |
26811-08-5 |
| Synonyms |
Dimethyl hydantoin formaldehyde resin; 2,4-Imidazolidinedione, dimethyl-, polymer with formaldehyde; DMHF; Dimethylhydantoin-formaldehyde resin; Formaldehyde, polymer with 5,5-dimethyl-2,4-imidazolidinedione; 5,5-dimethylimidazolidine-2,4-dione - formaldehyde (1:1) |
| Molecular Formula |
C6H10N2O3 |
| Molecular Weight |
158.1552 |
| InChI |
InChI=1/C5H8N2O2.CH2O/c1-5(2)3(8)6-4(9)7-5;1-2/h1-2H3,(H2,6,7,8,9);1H2 |
| EINECS |
500-052-9 |
| Molecular Structure |
|
| Boiling point |
244.1°C at 760 mmHg |
| Flash point |
106.6°C |
| Vapour Pressur |
0.031mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
