ChemNet > CAS > 104-45-0 1-méthoxy-4-propylbenzène
104-45-0 1-méthoxy-4-propylbenzène
| Nom |
1-méthoxy-4-propylbenzène |
| Synonymes |
; 4-Propylanisole = Dihydroanéthol = p-Propylanisole ; 4-n-Propylanisole |
| Nom anglais |
1-Methoxy-4-propylbenzene; 4-Propylanisole = Dihydroanethole = p-Propylanisole; 4-n-Propylanisole |
| Formule moléculaire |
C10H14O |
| Poids Moléculaire |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| Numéro de registre CAS |
104-45-0 |
| EINECS |
203-203-4 |
| Structure moléculaire |
|
| Densité |
0.922g/cm3 |
| Point d'ébullition |
211.4°C at 760 mmHg |
| Indice de réfraction |
1.49 |
| Point d'éclair |
82.3°C |
| Pression de vapeur |
0.266mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|